meisserite
Sign in to saveAlso known as IMA2013-039
Meisserite is a very rare uranium mineral with the formula Na5(UO2)(SO4)3(SO3OH)(H2O). It is interesting in being a natural uranyl salt with hydrosulfate (hydroxysulfate) anion, a feature shared with belakovskiite. Other chemically related minerals include fermiite, oppenheimerite, natrozippeite and plášilite. Most of these uranyl sulfate minerals was originally found in the Blue Lizard mine, San Juan County, Utah, USA. The mineral is named after Swiss mineralogist Nicolas Meisser.
Wikidata facts
- Subclass of
- sulfate mineral
Show 3 more facts
- chemical formula
- Na₅(UO₂)(SO₄)₃(SO₃OH)(H₂O)
- crystal system
- triclinic crystal system
- IMA Mineral Symbol
- Mss
via Wikidata · CC0
~2 min read
Encyclopedic overview
3 sectionsContents
- Association and origin
- Crystal structure
- References
{{infobox mineral | name = Meisserite | category = Sulfate mineral | image = | imagesize = | alt = | caption = | formula = Na5(UO2)(SO4)3(SO3OH)(H2O) | IMAsymbol = Mss | strunz = | dana = | system = Triclinic | class = Pinacoidal () (same H-M symbol) | symmetry = P | unit cell = a = 5.32, b = 11.51, c = 13.56 [Å], α = 102.96°, β = 97.41°, γ = 91.46° (approximated); Z = 2 | color = Pale green to yellowish-green | colour = | habit = prismatic | twinning = | cleavage = {100} and {001}, fair | fracture = | tenacity = Very brittle | mohs = 2 | luster = Vitreous | streak = Very pale yellow | diaphaneity = Translucent to transparent | gravity = | density = 3.21 (calculated) (approximated) | polish = | opticalprop = Biaxal (-) | refractive = nα=1.51, nβ=1.55, nγ=1.56 (approximated) | birefringence = | pleochroism = Colorless (X), pale yellow (Y), pale greenish-yellow (Z) | 2V = 60o | dispersion = Weak | extinction = | length fast/slow = | fluorescence = | absorption = | melt = | fusibility = | diagnostic = | solubility = | impurities = | alteration = | other = 25px Radioactive | references = }} Meisserite is a very rare uranium mineral with the formula Na5(UO2)(SO4)3(SO3OH)(H2O). It is interesting in being a natural uranyl salt with hydrosulfate (hydroxysulfate) anion, a feature shared with belakovskiite. Other chemically related minerals include fermiite, oppenheimerite, natrozippeite and plášilite. Most of these uranyl sulfate minerals was originally found in the Blue Lizard mine, San Juan County, Utah, USA. The mineral is named after Swiss mineralogist Nicolas Meisser.
==Association and origin== Meisserite is associated with other sulfate minerals: belakovskiite, johannite, chalcanthite, copiapite, ferrinatrite, and gypsum. It is resulting from post-mining oxidation of the primary uranium mineral - uraninite.
Excerpted from Wikipedia’s “meisserite” article, available under the CC BY-SA 4.0 licence.