acetyl coenzyme A

Also known as acetyl-CoA, acetylCoA, S-acetyl coenzyme A, S-acetyl-coenzyme A, S-acetyl-CoA, AcCoA

Chemical data

Formula: C23H38N7O17P3S
Molecular weight: 809.6 g/mol
IUPAC name: S-[2-[3-[[(2R)-4-[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] ethanethioate
SMILES: CC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=CN=C32)N)O)OP(=O)(O)O)O
InChIKey: ZSLZBFCDCINBPY-ZSJPKINUSA-N
XLogP: -5.6
Polar surface area: 389 Å²
H-bond donors: 9
H-bond acceptors: 22
Formal charge: 0

via PubChem

Wikidata facts

Has part: nitrogen
Mass: 809.125774

Show 6 more facts

chemical formula: C₂₃H₃₈N₇O₁₇P₃S
isomeric SMILES: CC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C2N=CN=C3N)O)OP(=O)(O)O)O
canonical SMILES: CC(=O)SCCNC(=O)CCNC(=O)C(C(C)(C)COP(=O)(O)OP(=O)(O)OCC1C(C(C(O1)N2C=NC3=C2N=CN=C3N)O)OP(=O)(O)O)O
found in taxon: Homo sapiens
Commons category: Acetyl-coenzyme A
subject has role: primary metabolite

Sources (6)

via Wikidata · CC0

~12 min read

Encyclopedic overview

9 sections

Contents

Role
Biosynthesis
Extramitochondrial
Intramitochondrial
Functions
Intermediates in various pathways
See also
References
External links

{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 477240040 | Name = Acetyl-CoA | ImageFile = Acetyl-CoA-2D_colored.svg | ImageClass= skin-invert-image | ImageSize = 320 | ImageFile2 = Acetyl-CoA-3D-balls.png | ImageSize2 = 320 | ImageFile3 = Acetyl-CoA-3D-vdW.png | ImageSize3 = 320 | PIN = O1-{(3R)-4-[(3-{[2-(Acetylsulfanyl)ethyl]amino}-3-oxopropyl)amino]-3-hydroxy-2,2-dimethyl-4-oxobutyl} O3-{[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-4-hydroxy-3-(phosphonooxy)oxolan-2-yl]methyl} dihydrogen diphosphate | OtherNames = | Section1 = | Section2 = | Section3 = | Section4 = | Section5 = | Section6 = }}

Acetyl-CoA (acetyl coenzyme A) is a molecule that participates in many biochemical reactions in protein, carbohydrate and lipid metabolism. Its main function is to deliver the acetyl group to the citric acid cycle (Krebs cycle) to be oxidized for energy production.

Excerpted from Wikipedia’s “acetyl coenzyme A” article, available under the CC BY-SA 4.0 licence.