folic acid
Sign in to saveFolate, also known as vitamin B9 and folacin, is one of the B vitamins. Manufactured folic acid, which is converted into folate by the body, is used as a dietary supplement and in food fortification as it is more stable during processing and storage. Folate is required for the body to make DNA and RNA and metabolise amino acids necessary for cell division and maturation of blood cells. As the human body cannot make folate, it is required in the diet, making it an essential nutrient. It occurs naturally in many foods. The recommended adult daily intake of folate in the U.S. is 400 micrograms fr
AI overview
Folic acid is a manufactured form of vitamin B9 that your body converts into folate, an essential nutrient needed to make DNA and RNA and support cell division and blood cell development. Since your body cannot produce folate on its own, you need to get it from food or supplements, and it's commonly added to foods and taken as a dietary supplement because it stays stable during processing and storage.
AI-generated from the Wikipedia summary — may contain errors.
Key facts
- Drug.IUPAC_name
- (2S)-2-[[4-[(2-Amino-4-oxo-1H-pteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid | C = 19 | H = 19 | N = 7 | O = 6 | SMILES = n1c2C(=O)NC(N)=Nc2ncc1CNc3ccc(cc3)C(=O)N[C@H](C(O)=O)CCC(O)=O | StdInChI = 1S/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t12-/m0/s1 | StdInChI_comment = | StdInChIKey = OVBPIULPVIDEAO-LBPRGKRZSA-N | density = 1.6±0.1 | density_notes = | melting_point = 250 | melting_high = | melting_notes = (decomposition) | boiling_point = | boiling_notes = | solubility = 1.6 | sol_units = mg/L (25 °C) | specific_rotation =
- Drug.drug_name
- Folic acid
- Drug.image
- Folic acid.svg
- Drug.image_class
- skin-invert-image
- Drug.width
- 260
- Drug.alt
- Skeletal formula
- Drug.image2
- Folic-acid-from-xtal-3D-bs-17.png
- Drug.image_class2
- bg-transparent
- Drug.width2
- 280
- Drug.tradename
Article
32 sectionsContents
- Definition
- Health effects
- Birth defects
- Fertility
- Heart disease
- Stroke
- Cancer
- Anti-folate chemotherapy
- Neurological disorders
- Folic acid, B<sub>12</sub> and iron
- Malaria
- Absorption, metabolism and excretion
- Biosynthesis
- Bioactivation
- Drug interference
- Function
- DNA synthesis
- Vitamin B<sub>12</sub> activation
- Dietary recommendations
- Safety
- Food labeling
- Deficiency
- Sources
- Food fortification
- Australia and New Zealand
- Canada
- United Kingdom
- United States
- History
- Animals
- References
- External links
{{Infobox drug | drug_name = Folic acid | image = Folic acid.svg | image_class = skin-invert-image | width = 260 | alt = Skeletal formula | caption = | image2 = Folic-acid-from-xtal-3D-bs-17.png | image_class2 = bg-transparent | width2 = 280 | alt2 = | pronounce = | tradename = Folicet, Folvite | Drugs.com = | MedlinePlus = a682591 | DailyMedID = Folic acid | pregnancy_AU = A | pregnancy_AU_comment = | pregnancy_category = | routes_of_administration = By mouth, intramuscular, intravenous, subcutaneous | class = | ATC_prefix = B03 | ATC_suffix = BB01 | ATC_supplemental =
| legal_AU = S4 | legal_AU_comment = / S2 | legal_BR = | legal_BR_comment = | legal_CA = | legal_CA_comment = | legal_DE = | legal_DE_comment = | legal_NZ = | legal_NZ_comment = | legal_UK = | legal_UK_comment = | legal_US = Rx-only | legal_US_comment = / OTC | legal_EU = | legal_EU_comment = | legal_UN = | legal_UN_comment = | legal_status =