تلاپرویر

Also known as VX-950, VX 950, (1S,3aR,6aS)-(2S)-2-cyclohexyl-N-(pyrazinylcarbonyl)glycyl-3-methyl-L-valyl-N-((1S)-1-((cyclopropylamino)oxoacetyl)butyl)octahydrocyclopenta(c)pyrrole-1-carboxamide, (1S,3AR,6as)-(2S)-2-cyclohexyl-N-(pyrazinylcarbonyl)glycyl-3-methyl-L-valyl-N-((1S)-1-((cyclopropylamino)oxoacetyl)butyl)octahydrocyclopenta(c)pyrrole-1-carboxamide, Telaprevir

Telaprevir (VX-950), was marketed under the brand names Incivek and Incivo, is a pharmaceutical drug for the treatment of hepatitis C co-developed by Vertex Pharmaceuticals and Johnson & Johnson. It is a member of a class of antiviral drugs known as protease inhibitors. Specifically, telaprevir inhibits the hepatitis C viral enzyme NS3/4A serine protease. Telaprevir is only indicated for use against hepatitis C genotype 1 viral infections and has not been proven to be safe or effective when used for other genotypes of the virus. The standard therapy of pegylated interferon and ribavirin is les

Key facts

Drug.Verifiedfields: changed
Drug.Watchedfields: changed
Drug.verifiedrevid: 458630745
Drug.IUPAC_name: (1S,3aR,6aS)-2-[(2S)-2-[[(2S)-2-Cyclohexyl-2-(pyrazine-2-carbonylamino)acetyl]amino]-3,3-dimethylbutanoyl]-N-[(3S)-1-(cyclopropylamino)-1,2-dioxohexan-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-1-carboxamide | image = Telaprevir structure.svg | image_class = skin-invert-image | width = 280 | tradename = Incivek, Incivo | Drugs.com = | MedlinePlus = a611038 | licence_US = Telaprevir | pregnancy_AU = | pregnancy_US = B | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = Rx-only | legal_status = | routes_of_administration = Oral | bioavailability = | protein_bound = 59–76% | metabolism = extensive hepatic | elimination_half-life = 9–11 hours | excretion = 90% (bile), 9% (exhaled air), 1% (urine) | IUPHAR_ligand = 7871 | CAS_number_Ref = | CAS_number = 402957-28-2 | ATC_prefix = J05 | ATC_suffix = AP02 | ChEBI_Ref = | ChEBI = 68595 | ChEMBL_Ref = | ChEMBL = 231813 | PubChem = 3010818 | DrugBank_Ref = | DrugBank = DB05521 | ChemSpiderID_Ref = | ChemSpiderID = 2279948 | UNII_Ref = | UNII = 655M5O3W0U | KEGG_Ref = | KEGG = D09012 | NIAID_ChemDB = 213006 | C=36 | H=53 | N=7 | O=6 | StdInChI_Ref = | StdInChI = 1S/C36H53N7O6/c1-5-10-25(29(44)34(48)39-23-15-16-23)40-33(47)28-24-14-9-13-22(24)20-43(28)35(49)30(36(2,3)4)42-32(46)27(21-11-7-6-8-12-21)41-31(45)26-19-37-17-18-38-26/h17-19,21-25,27-28,30H,5-16,20H2,1-4H3,(H,39,48)(H,40,47)(H,41,45)(H,42,46)/t22-,24-,25-,27-,28-,30+/m0/s1 | StdInChIKey_Ref = | StdInChIKey = BBAWEDCPNXPBQM-GDEBMMAJSA-N | SMILES = CCC[C@@H](C(=O)C(=O)NC1CC1)NC(=O)[C@@H]2[C@H]3CCC[C@H]3CN2C(=O)[C@H](C(C)(C)C)NC(=O)[C@H](C4CCCCC4)NC(=O)c5cnccn5 | SMILES2 = C0CC0NC(=O)C(=O)[C@H](CCC)NC(=O)[C@@H]1[C@H]2CCC[C@H]2CN1C(=O)[C@H](C(C)(C)C)NC(=O)[C@H](C3CCCCC3)NC(=O)c4nccnc4

via Wikipedia infobox