drinabant

Drinabant (INN; AVE-1625) is a drug that acts as a selective CB1 receptor antagonist, which was under investigation varyingly by Sanofi-Aventis as a treatment for obesity, schizophrenia, Alzheimer's disease, Parkinson's disease, and nicotine dependence. Though initially studied as a potential treatment for a variety of different medical conditions, Sanofi-Aventis eventually narrowed down the therapeutic indications of the compound to just appetite suppression. Drinabant reached phase IIb clinical trials for this purpose in the treatment of obesity but was shortly thereafter discontinued, likel

Wikidata facts

Mass: 496.059

Show 3 more facts

canonical SMILES: CS(=O)(=O)N(C1CN(C1)C(C2=CC=C(C=C2)Cl)C3=CC=C(C=C3)Cl)C4=CC(=CC(=C4)F)F
chemical formula: C₂₃H₂₀Cl₂F₂N₂O₂S
Commons category: Drinabant

Sources (2)

via Wikidata · CC0

~3 min read

Article

2 sections

Contents

See also
References

{{Drugbox | IUPAC_name = (±)-N-{1-[Bis(4-chlorophenyl)methyl]-3-azetidinyl}-N-(3,5-difluorophenyl)methanesulfonamide | image = Drinabant.svg | image_class = skin-invert-image | image2 = Drinabant ball-and-stick model.png | image_class2 = bg-transparent | CAS_number = 358970-97-5 | CAS_supplemental = | UNII_Ref = | UNII = 61S98RLL5I | ATC_prefix = None | ATC_suffix = | PubChem = 10278470 | ChemSpiderID = 8453947 | C = 23 | H = 20 | Cl = 2 | F = 2 | N = 2 | O = 2 | S = 1 | smiles = Fc1cc(cc(F)c1)N(C4CN(C(c2ccc(Cl)cc2)c3ccc(Cl)cc3)C4)S(=O)(=O)C | StdInChI = 1S/C23H20Cl2F2N2O2S/c1-32(30,31)29(21-11-19(26)10-20(27)12-21)22-13-28(14-22)23(15-2-6-17(24)7-3-15)16-4-8-18(25)9-5-16/h2-12,22-23H,13-14H2,1H3 | StdInChIKey = IQQBRKLVEALROM-UHFFFAOYSA-N | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | pregnancy_category = | routes_of_administration = }}