I don't see any context provided in your message to base the overview on. Could you please share the context about remdesivir that you'd like me to use as the foundation for this overview?
AI-generated from the Wikipedia summary — may contain errors.
{{Infobox drug | image = Remdesivir.svg | image_class = skin-invert-image | width = | alt = | caption = | image2 = Remdesivir-from-xtal-Mercury-3D-ball-and-stick-with-bond-orders.png | image_class2 = bg-transparent | width2 = | alt2 = | pronounce = | tradename = Veklury | Drugs.com = | MedlinePlus = a620033 | DailyMedID = Remdesivir | pregnancy_AU = B2 | pregnancy_AU_comment = | pregnancy_category = | routes_of_administration = Intravenous | class = Antiviral | ATC_prefix = J05 | ATC_suffix = AB16 | ATC_supplemental = | legal_AU = S4 | legal_AU_comment = | legal_BR = | legal_BR_comment = | legal_CA = Rx-only | legal_CA_comment = | legal_DE = | legal_DE_comment = | legal_NZ = | legal_NZ_comment = | legal_UK = POM | legal_UK_comment = | legal_US = Rx-only | legal_US_comment = | legal_EU = Rx-only | legal_EU_comment = | legal_UN = | legal_UN_comment = | legal_status = Schedule H | bioavailability = | protein_bound = | metabolism = | metabolites = | onset = | elimination_half-life = | duration_of_action = | excretion = | CAS_number = 1809249-37-3 | CAS_supplemental = | PubChem = 121304016 | IUPHAR_ligand = | DrugBank = DB14761 | ChemSpiderID = 58827832 | UNII = 3QKI37EEHE | KEGG = D11472 | ChEBI = 145994 | ChEMBL = 4065616 | NIAID_ChemDB = | PDB_ligand = | synonyms = GS-5734, RDV
| IUPAC_name = (2S)-2-{(2R,3S,4R,5R)-[5-(4-Aminopyrrolo[2,1-f] [1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxy-tetrahydro-furan-2-ylmethoxy]phenoxy-(S)-phosphorylamino}propionic acid 2-ethyl-butyl ester | C = 27 | H = 35 | N = 6 | O = 8 | P = 1 | SMILES = CCC(COC(=O)[C@@H](NP(=O)(Oc1ccccc1)OC[C@H]1O[C@@]([C@@H]([C@@H]1O)O)(C#N)c1ccc2n1ncnc2N)C)CC | StdInChI = 1S/C27H35N6O8P/c1-4-18(5-2)13-38-26(36)17(3)32-42(37,41-19-9-7-6-8-10-19)39-14-21-23(34)24(35)27(15-28,40-21)22-12-11-20-25(29)30-16-31-33(20)22/h6-12,16-18,21,23-24,34-35H,4-5,13-14H2,1-3H3,(H,32,37)(H2,29,30,31)/t17-,21+,23+,24+,27-,42-/m0/s1 | StdInChI_comment = | StdInChIKey = RWWYLEGWBNMMLJ-YSOARWBDSA-N | density = | density_notes = | melting_point = | melting_high = | melting_notes = | boiling_point = | boiling_notes = | solubility = | sol_units = | specific_rotation = }} Remdesivir, sold under the brand name Veklury, is a broad-spectrum antiviral medication developed by the biopharmaceutical company Gilead Sciences. It is administered via injection into a vein. During the COVID19 pandemic, remdesivir was approved or authorized for emergency use to treat COVID19 in numerous countries.
via Wikipedia infobox
Discovered by embedding cosine similarity (sentence-transformers MiniLM, 384-dim).