terutroban

{{drugbox | Verifiedfields = changed | Watchedfields = changed | UNII_Ref = | UNII = A6WX9391D8 | verifiedrevid = 407704475 | IUPAC_name = 3-((6R)-6-{[(4-Chlorophenyl)sulfonyl]amido}-2-methyl-5,6,7,8-tetrahydronaphthalen-1-yl]propanoic acid | image = Terutroban acid skeletal.svg | image_class = skin-invert-image | CAS_number_Ref = | CAS_number = 165538-40-9 | CAS_supplemental = (sodium salt) | ATC_prefix = none | ATC_suffix = | ATC_supplemental = | PubChem = 9938840 | ChemSpiderID_Ref = | ChemSpiderID = 8114465 | StdInChI_Ref = | StdInChI = 1S/C20H22ClNO4S/c1-13-2-3-14-12-16(6-9-19(14)18(13)10-11-20(23)24)22-27(25,26)17-7-4-15(21)5-8-17/h2-5,7-8,16,22H,6,9-12H2,1H3,(H,23,24)/t16-/m1/s1 | StdInChIKey_Ref = | StdInChIKey = HWEOXFSBSQIWSY-MRXNPFEDSA-N | DrugBank_Ref = | DrugBank = | chemical_formula = | C=20 | H=22 | Cl=1 | N=1 | O=4 | S=1 | smiles = CC1=C(C2=C(CC(CC2)NS(=O)(=O)C3=CC=C(C=C3)Cl)C=C1)CCC(=O)O | bioavailability = | protein_bound = | metabolism = | elimination_half-life = 6–10 hours | excretion = | pregnancy_AU = | pregnancy_US = | pregnancy_category= | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = Investigational | routes_of_administration = Oral }}

Terutroban is an antiplatelet agent developed by Servier Laboratories. It is a selective thromboxane prostanoid (TP) antagonist and is an orally active drug in clinical development for the secondary prevention of acute thrombotic complications.