EntityQ187706· pop 72· linked from 1,219 articles

维生素B12

Also known as cobalamin

vitamin involved in the metabolism of every cell

AI overview

Vitamin B12 is a nutrient that plays a role in how every cell in your body uses energy and processes nutrients. Your body needs it to function properly, though the exact details of all its functions are complex.

AI-generated from the Wikipedia summary — may contain errors.

Chemical data

Formula: C63H88CoN14O14P
Molecular weight: 1355.4 g/mol
IUPAC name: cobalt(3+);[5-(5,6-dimethylbenzimidazol-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] 1-[3-[2,13,18-tris(2-amino-2-oxoethyl)-7,12,17-tris(3-amino-3-oxopropyl)-3,5,8,8,13,15,18,19-octamethyl-2,7,12,17-tetrahydro-1H-corrin-21-id-3-yl]propanoylamino]propan-2-yl phosphate;cyanide
SMILES: CC1=CC2=C(C=C1C)N(C=N2)C3C(C(C(O3)CO)OP(=O)([O-])OC(C)CNC(=O)CCC4(C(C5C6(C(C(C(=N6)C(=C7C(C(C(=N7)C=C8C(C(C(=N8)C(=C4[N-]5)C)CCC(=O)N)(C)C)CCC(=O)N)(C)CC(=O)N)C)CCC(=O)N)(C)CC(=O)N)C)CC(=O)N)C)O.[C-]#N.[Co+3]
InChIKey: FDJOLVPMNUYSCM-UHFFFAOYSA-L
Polar surface area: 476 Å²
H-bond donors: 9
H-bond acceptors: 21
Formal charge: 0