candesartan

Also known as CV-11974, TCV-116 (prodrug), 2-ethoxy-1-(p-(o-1H-tetrazol-5-ylphenyl)benzyl)-7-benzimidazolecarboxylic acid, 2-ethoxy-1-{[2'-(1H-tetrazol-5-yl)biphenyl-4ethyl]}-1H-benzimidazole-7-carboxylic acid, 2-ethoxy-1-{[2'-(1H-tetrazol-5-yl)biphenyl-4-yl]methyl}-1H-benzimidazole-7-carboxylic acid

Candesartan is an angiotensin receptor blocker (ARB) primarily used to treat high blood pressure and congestive heart failure. It is always administered in its inactive prodrug form, candesartan cilexetil, which is converted to the active drug during absorption in the gastrointestinal tract. Like olmesartan, candesartan is a cascading prodrug, a feature that influences its pharmacokinetics. It has good bioavailability and is considered one of the most potent AT1 receptor antagonists by weight. Its effective maintenance dose is also relatively low.

Key facts

Drug.drug_name: Candesartan cilexetil
Drug.Verifiedfields: changed
Drug.Watchedfields: changed
Drug.verifiedrevid: 460015915
Drug.IUPAC_name: 1-cyclohexyloxycarbonyloxyethyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate | image = Candesartan Cilexetil.svg | image_class = skin-invert-image | synonyms = | pronounce = | tradename = Atacand, others | Drugs.com = | MedlinePlus = a601033 | pregnancy_AU = D | pregnancy_category = | legal_status = Rx-only | routes_of_administration = By mouth | bioavailability = 15% (candesartan cilexetil) | metabolism = Candesartan cilexetil: intestinal wall; candesartan: hepatic (CYP2C9) | elimination_half-life = 9 hours | excretion = Kidney 33%, faecal 67% | CAS_number_Ref = | CAS_number = 145040-37-5 | ATC_prefix = C09 | ATC_suffix = CA06 | PubChem = 2541 | IUPHAR_ligand = 8352 | DrugBank_Ref = | DrugBank = DB00796 | ChemSpiderID_Ref = | ChemSpiderID = 2444 | UNII_Ref = | UNII = R85M2X0D68 | KEGG_Ref = | KEGG = D00626 | ChEBI_Ref = | ChEBI = 3348 | ChEMBL_Ref = | ChEMBL = 1014 | C=33 | H=34 | N=6 | O=6 | smiles = CCOC1=NC2=CC=CC(=C2N1CC3=CC=C(C=C3)C4=CC=CC=C4C5=NNN=N5)C(=O)OC(C)OC(=O)OC6CCCCC6 | StdInChI_Ref = | StdInChI = 1S/C33H34N6O6/c1-3-42-32-34-28-15-9-14-27(31(40)43-21(2)44-33(41)45-24-10-5-4-6-11-24)29(28)39(32)20-22-16-18-23(19-17-22)25-12-7-8-13-26(25)30-35-37-38-36-30/h7-9,12-19,21,24H,3-6,10-11,20H2,1-2H3,(H,35,36,37,38) | StdInChIKey_Ref = | StdInChIKey = GHOSNRCGJFBJIB-UHFFFAOYSA-N

via Wikipedia infobox