EA-4056

EA-4056 is a deadly carbamate nerve agent. It is lethal because it inhibits acetylcholinesterase. Inhibition causes an overly high accumulation of acetylcholine between the nerve and muscle cells. This paralyzes the muscles by preventing their relaxation. The paralyzed muscles include those used for breathing.

In the Vinony graph

Within Vinony's link graph, EA-4056 is referenced by 456 other articles, and connects out to botulinum toxin group, T-1123 and mustard gas.

It sits within the topics Acetylcholinesterase inhibitors, Aromatic carbamates and Biscarbamates.

Its subject is documented across 5 Wikipedia language editions.

Chemical data

Formula: C31H52Br2N6O4
Molecular weight: 732.6 g/mol
IUPAC name: [3-(dimethylcarbamoyloxy)-2-pyridinyl]methyl-[9-[[3-(dimethylcarbamoyloxy)-2-pyridinyl]methyl-dimethylazaniumyl]nonyl]-dimethylazanium dibromide
SMILES: CN(C)C(=O)OC1=C(N=CC=C1)C[N+](C)(C)CCCCCCCCC[N+](C)(C)CC2=C(C=CC=N2)OC(=O)N(C)C.[Br-].[Br-]
InChIKey: AQIHLGWYYFRMKZ-UHFFFAOYSA-L
Polar surface area: 84.9 Å²
H-bond donors: 0
H-bond acceptors: 8
Formal charge: 0

via PubChem

Wikidata facts

Subclass of: chemical compound
Mass: 730.241678344

Show 3 more facts

canonical SMILES: CN(C)C(=O)OC1=C(N=CC=C1)C[N+](C)(C)CCCCCCCCC[N+](C)(C)CC2=C(C=CC=N2)OC(=O)N(C)C.[Br-].[Br-]
Commons category: EA-4056
chemical formula: C₃₁H₅₂Br₂N₆O₄

via Wikidata · CC0

~4 min read

Encyclopedic overview

5 sections

Contents

Lethality
Properties
Synthesis
See also
References

{{Chembox | Name = EA-4056 | ImageFile = EA_4056.png | ImageClass = skin-invert-image | ImageFile1 = EA-4056_3D_structure.png | ImageClass1 = bg-transparent | OtherNames = | IUPACName = 1,9-Bis[methyl-2(3-dimethylcarbamoxypyridyl)methylamino]nonane dimethobromide | PIN = N1,N9-Bis({3-[(dimethylcarbamoyl)oxy]pyridin-2-yl}methyl)-N1,N1,N9,N9-tetramethylnonane-1,9-bis(aminium) dibromide | SystematicName = | Section1 = | Section2 = | Section3 = | Section4 = | Section5 = | Section6 = }}

Excerpted from Wikipedia’s “EA-4056” article, available under the CC BY-SA 4.0 licence.