Skip to content
EntityQ15053666· pop 18· linked from 630 articles

vilanterol

Sign in to save

Also known as GW642444X, GW-642444x, vilantérol, 4-{(1R)-2-[(6-{2-[(2,6-dichlorobenzyl)oxy]ethoxy}hexyl)amino]-1-hydroxyethyl}-2-(hydroxymethyl)phenol

Vilanterol is an ultra-long-acting β2-adrenoceptor agonist which was approved in May 2013 in combination with fluticasone furoate for sale as Breo Ellipta by GlaxoSmithKline for the treatment of chronic obstructive pulmonary disease (COPD). The combination is also approved for the treatment of asthma in Canada, Europe, Japan and New Zealand.

~2 min read

Encyclopedic overview

2 sections
Contents
  • See also
  • References

{{Drugbox | drug_name = | IUPAC_name = 4-{(1R)-2-[(6-{2-[(2,6-Dichlorobenzyl)oxy]ethoxy}hexyl)amino]-1-hydroxyethyl}-2-(hydroxymethyl)phenol | image = Vilanterol.svg | image_class = skin-invert-image | width = 220 | alt = | caption = | tradename = | Drugs.com = | MedlinePlus = | pregnancy_AU = B3 | pregnancy_US = | pregnancy_category = | licence_EU = yes | legal_AU = S4 | legal_CA = | legal_UK = POM | legal_US = Rx-only | legal_status = Rx-only | routes_of_administration = | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | CAS_number = 503068-34-6 | ATCvet = | ATC_prefix = R03 | ATC_suffix = AK10 | ATC_supplemental = (+fluticasone) (+umeclidinium) | PubChem = 10184665 | UNII_Ref = | UNII = 028LZY775B | ChemSpiderID = 8360167 | IUPHAR_ligand = 7353 | DrugBank = | ChEBI = 75037 | ChEMBL = 1198857 | KEGG = D09696

| C = 24 | H = 33 | Cl = 2 | N = 1 | O = 5 | smiles = c1cc(c(c(c1)Cl)COCCOCCCCCCNC[C@@H](c2ccc(c(c2)CO)O)O)Cl | StdInChI = 1S/C24H33Cl2NO5/c25-21-6-5-7-22(26)20(21)17-32-13-12-31-11-4-2-1-3-10-27-15-24(30)18-8-9-23(29)19(14-18)16-28/h5-9,14,24,27-30H,1-4,10-13,15-17H2/t24-/m0/s1 | StdInChIKey = DAFYYTQWSAWIGS-DEOSSOPVSA-N }}

Excerpted from Wikipedia’s “vilanterol” article, available under the CC BY-SA 4.0 licence.