vilanterol

Also known as GW642444X, GW-642444x, vilantérol, 4-{(1R)-2-[(6-{2-[(2,6-dichlorobenzyl)oxy]ethoxy}hexyl)amino]-1-hydroxyethyl}-2-(hydroxymethyl)phenol

Vilanterol is an ultra-long-acting β2-adrenoceptor agonist which was approved in May 2013 in combination with fluticasone furoate for sale as Breo Ellipta by GlaxoSmithKline for the treatment of chronic obstructive pulmonary disease (COPD). The combination is also approved for the treatment of asthma in Canada, Europe, Japan and New Zealand.

Wikidata facts

Mass: 485.173579

Show 5 more facts

chemical formula: C₂₄H₃₃Cl₂NO₅
isomeric SMILES: C1=CC(=C(C(=C1)Cl)COCCOCCCCCCNC[C@@H](C2=CC(=C(C=C2)O)CO)O)Cl
canonical SMILES: C1=CC(=C(C(=C1)Cl)COCCOCCCCCCNCC(C2=CC(=C(C=C2)O)CO)O)Cl
Commons category: Vilanterol
World Health Organisation international non-proprietary name: vilanterol

Sources (3)

via Wikidata · CC0

~2 min read

Article

2 sections

Contents

See also
References

{{Drugbox | drug_name = | IUPAC_name = 4-{(1R)-2-[(6-{2-[(2,6-Dichlorobenzyl)oxy]ethoxy}hexyl)amino]-1-hydroxyethyl}-2-(hydroxymethyl)phenol | image = Vilanterol.svg | image_class = skin-invert-image | width = 220 | alt = | caption = | tradename = | Drugs.com = | MedlinePlus = | pregnancy_AU = B3 | pregnancy_US = | pregnancy_category = | licence_EU = yes | legal_AU = S4 | legal_CA = | legal_UK = POM | legal_US = Rx-only | legal_status = Rx-only | routes_of_administration = | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | CAS_number = 503068-34-6 | ATCvet = | ATC_prefix = R03 | ATC_suffix = AK10 | ATC_supplemental = (+fluticasone) (+umeclidinium) | PubChem = 10184665 | UNII_Ref = | UNII = 028LZY775B | ChemSpiderID = 8360167 | IUPHAR_ligand = 7353 | DrugBank = | ChEBI = 75037 | ChEMBL = 1198857 | KEGG = D09696

| C = 24 | H = 33 | Cl = 2 | N = 1 | O = 5 | smiles = c1cc(c(c(c1)Cl)COCCOCCCCCCNC[C@@H](c2ccc(c(c2)CO)O)O)Cl | StdInChI = 1S/C24H33Cl2NO5/c25-21-6-5-7-22(26)20(21)17-32-13-12-31-11-4-2-1-3-10-27-15-24(30)18-8-9-23(29)19(14-18)16-28/h5-9,14,24,27-30H,1-4,10-13,15-17H2/t24-/m0/s1 | StdInChIKey = DAFYYTQWSAWIGS-DEOSSOPVSA-N }}