Vilanterol is an ultra-long-acting β2-adrenoceptor agonist which was approved in May 2013 in combination with fluticasone furoate for sale as Breo Ellipta by GlaxoSmithKline for the treatment of chronic obstructive pulmonary disease (COPD). The combination is also approved for the treatment of asthma in Canada, Europe, Japan and New Zealand.
{{Drugbox | drug_name = | IUPAC_name = 4-{(1R)-2-[(6-{2-[(2,6-Dichlorobenzyl)oxy]ethoxy}hexyl)amino]-1-hydroxyethyl}-2-(hydroxymethyl)phenol | image = Vilanterol.svg | image_class = skin-invert-image | width = 220 | alt = | caption = | tradename = | Drugs.com = | MedlinePlus = | pregnancy_AU = B3 | pregnancy_US = | pregnancy_category = | licence_EU = yes | legal_AU = S4 | legal_CA = | legal_UK = POM | legal_US = Rx-only | legal_status = Rx-only | routes_of_administration = | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | CAS_number = 503068-34-6 | ATCvet = | ATC_prefix = R03 | ATC_suffix = AK10 | ATC_supplemental = (+fluticasone) (+umeclidinium) | PubChem = 10184665 | UNII_Ref = | UNII = 028LZY775B | ChemSpiderID = 8360167 | IUPHAR_ligand = 7353 | DrugBank = | ChEBI = 75037 | ChEMBL = 1198857 | KEGG = D09696
| C = 24 | H = 33 | Cl = 2 | N = 1 | O = 5 | smiles = c1cc(c(c(c1)Cl)COCCOCCCCCCNC[C@@H](c2ccc(c(c2)CO)O)O)Cl | StdInChI = 1S/C24H33Cl2NO5/c25-21-6-5-7-22(26)20(21)17-32-13-12-31-11-4-2-1-3-10-27-15-24(30)18-8-9-23(29)19(14-18)16-28/h5-9,14,24,27-30H,1-4,10-13,15-17H2/t24-/m0/s1 | StdInChIKey = DAFYYTQWSAWIGS-DEOSSOPVSA-N }}
Discovered by embedding cosine similarity (sentence-transformers MiniLM, 384-dim).