Chlorphenoxamine (Phenoxene) is an antihistamine and anticholinergic used as an antipruritic and antiparkinsonian agent. It is an analog of diphenhydramine.
via PubMed
{{Drugbox |Verifiedfields = changed |Watchedfields = changed |verifiedrevid = 447811372 |IUPAC_name = {2-[1-(4-chlorophenyl)-1-phenylethoxy]ethyl}dimethylamine |image = Chlorphenoxamine.svg |image_class = skin-invert-image |Drugs.com = |routes_of_administration = Oral, topical |bioavailability = Well absorbed |metabolism = Likely liver |excretion = kidney |CAS_number_Ref = |CAS_number = 77-38-3 |CAS_supplemental = |ATC_prefix = D04 |ATC_suffix = AA34 |ATC_supplemental = |PubChem = 6475 |DrugBank_Ref = |DrugBank = DB09007 |ChemSpiderID_Ref = |ChemSpiderID = 6230 |ChEMBL_Ref = |ChEMBL = 2110774 |UNII_Ref = |UNII = 3UVD77BP8R |KEGG_Ref = |KEGG = D07198 |C=18 | H=22 | Cl=1 | N=1 | O=1 |smiles = Clc1ccc(cc1)C(OCCN(C)C)(c2ccccc2)C |StdInChI_Ref = |StdInChI = 1S/C18H22ClNO/c1-18(21-14-13-20(2)3,15-7-5-4-6-8-15)16-9-11-17(19)12-10-16/h4-12H,13-14H2,1-3H3 |StdInChIKey_Ref = |StdInChIKey = KKHPNPMTPORSQE-UHFFFAOYSA-N }}
Chlorphenoxamine (Phenoxene) is an antihistamine and anticholinergic used as an antipruritic and antiparkinsonian agent. It is an analog of diphenhydramine.
Discovered by embedding cosine similarity (sentence-transformers MiniLM, 384-dim).