Simvastatin, sold under the brand name Zocor among others, is a statin, a type of lipid-lowering medication. It is used along with exercise, diet, and weight loss to decrease elevated lipid levels. It is also used to decrease the risk of heart problems in those at high risk. It is taken by mouth.
{{Drugbox | verifiedrevid = 464391842 | image = Simvastatin.svg | image_class = skin-invert-image | width = 200 | alt = | image2 = Simvastatin3Dan.gif | image_class2 = bg-transparent | width2 = 200 | alt2 = | pronounce = | tradename = Zocor, other | Drugs.com = | MedlinePlus = a692030 | DailyMedID = Simvastatin | pregnancy_AU = D | routes_of_administration = By mouth | ATC_prefix = C10 | ATC_suffix = AA01 | legal_AU = S4 | legal_UK = POM | legal_UK_comment = | legal_US = Rx-only | legal_US_comment = | legal_EU = Rx-only | legal_EU_comment = | bioavailability = 5% | protein_bound = 95% | metabolism = Liver (CYP3A4) | elimination_half-life = 2 hours for simvastatin and 1.9 hours for simvastatin acid | excretion = Kidney 13%, faecal 60% | IUPHAR_ligand = 2955 | CAS_number_Ref = | CAS_number = 79902-63-9 | PubChem = 54454 | DrugBank_Ref = | DrugBank = DB00641 | ChemSpiderID_Ref = | ChemSpiderID = 49179 | UNII_Ref = | UNII = AGG2FN16EV | KEGG_Ref = | KEGG = D00434 | ChEBI_Ref = | ChEBI = 9150 | ChEMBL_Ref = | ChEMBL = 1064 | IUPAC_name = (1S,3R,7S,8S,8aR)-8-{2-[(2R,4R)-4-hydroxy-6-oxotetrahydro-2H-pyran-2-yl]ethyl}-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl 2,2-dimethylbutanoate | C=25 | H=38 | O=5 | smiles = O=C(O[C@@H]1[C@H]3C(=C/[C@H](C)C1)\C=C/[C@@H]([C@@H]3CC[C@H]2OC(=O)C[C@H](O)C2)C)C(C)(C)CC | StdInChI_Ref = | StdInChI = 1S/C25H38O5/c1-6-25(4,5)24(28)30-21-12-15(2)11-17-8-7-16(3)20(23(17)21)10-9-19-13-18(26)14-22(27)29-19/h7-8,11,15-16,18-21,23,26H,6,9-10,12-14H2,1-5H3/t15-,16-,18+,19+,20-,21-,23-/m0/s1 | StdInChIKey_Ref = | StdInChIKey = RYMZZMVNJRMUDD-HGQWONQESA-N }}
Simvastatin, sold under the brand name Zocor among others, is a statin, a type of lipid-lowering medication. It is used along with exercise, diet, and weight loss to decrease elevated lipid levels. It is also used to decrease the risk of heart problems in those at high risk. It is taken by mouth.
Discovered by embedding cosine similarity (sentence-transformers MiniLM, 384-dim).