Structure via PubChem · Public domain (PubChem)
Also known as MK-733, Zocor®, Zocor, 2,2-dimethylbutyric acid, 8-ester with (4R,6R)-6-(2-((1S,2S,6R,8S,8aR)-1,2,6,7,8,8a-hexahydro-8-hydroxy-2,6-dimethyl-1-naphthyl)ethyl)tetrahydro-4-hydroxy-2H-pyran-2-one, Cholestat, Sinvacor, Simcor
Simvastatin, sold under the brand name Zocor among others, is a statin, a type of lipid-lowering medication. It is used along with exercise, diet, and weight loss to decrease elevated lipid levels. It is also used to decrease the risk of heart problems in those at high risk. It is taken by mouth.
via PubChem
~14 min read
{{Drugbox | verifiedrevid = 464391842 | image = Simvastatin.svg | image_class = skin-invert-image | width = 200 | alt = | image2 = Simvastatin3Dan.gif | image_class2 = bg-transparent | width2 = 200 | alt2 = | pronounce = | tradename = Zocor, other | Drugs.com = | MedlinePlus = a692030 | DailyMedID = Simvastatin | pregnancy_AU = D | routes_of_administration = By mouth | ATC_prefix = C10 | ATC_suffix = AA01 | legal_AU = S4 | legal_UK = POM | legal_UK_comment = | legal_US = Rx-only | legal_US_comment = | legal_EU = Rx-only | legal_EU_comment = | bioavailability = 5% | protein_bound = 95% | metabolism = Liver (CYP3A4) | elimination_half-life = 2 hours for simvastatin and 1.9 hours for simvastatin acid | excretion = Kidney 13%, faecal 60% | IUPHAR_ligand = 2955 | CAS_number_Ref = | CAS_number = 79902-63-9 | PubChem = 54454 | DrugBank_Ref = | DrugBank = DB00641 | ChemSpiderID_Ref = | ChemSpiderID = 49179 | UNII_Ref = | UNII = AGG2FN16EV | KEGG_Ref = | KEGG = D00434 | ChEBI_Ref = | ChEBI = 9150 | ChEMBL_Ref = | ChEMBL = 1064 | IUPAC_name = (1S,3R,7S,8S,8aR)-8-{2-[(2R,4R)-4-hydroxy-6-oxotetrahydro-2H-pyran-2-yl]ethyl}-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl 2,2-dimethylbutanoate | C=25 | H=38 | O=5 | smiles = O=C(O[C@@H]1[C@H]3C(=C/[C@H](C)C1)\C=C/[C@@H]([C@@H]3CC[C@H]2OC(=O)C[C@H](O)C2)C)C(C)(C)CC | StdInChI_Ref = | StdInChI = 1S/C25H38O5/c1-6-25(4,5)24(28)30-21-12-15(2)11-17-8-7-16(3)20(23(17)21)10-9-19-13-18(26)14-22(27)29-19/h7-8,11,15-16,18-21,23,26H,6,9-10,12-14H2,1-5H3/t15-,16-,18+,19+,20-,21-,23-/m0/s1 | StdInChIKey_Ref = | StdInChIKey = RYMZZMVNJRMUDD-HGQWONQESA-N }}
Simvastatin, sold under the brand name Zocor among others, is a statin, a type of lipid-lowering medication. It is used along with exercise, diet, and weight loss to decrease elevated lipid levels. It is also used to decrease the risk of heart problems in those at high risk. It is taken by mouth.
via PubMed
via Wikidata · CC0
via Wikidata sitelinks · CC0
Discovered by embedding cosine similarity (sentence-transformers MiniLM, 384-dim).