Skip to content
alacepril
EntityQ3290792· pop 13· linked from 80 articles

Alacepril (INN) is an ACE inhibitor medication indicated as a treatment for hypertension. The medication metabolizes to captopril and desacetylalacepril. Alacepril is primarily used to treat hypertension, and in some cases, renovascular hypertension. It's often combined with other medications, particularly other blood pressure lowering classes of medications like thiazide diuretics to maximize its effectiveness.

Key facts

Drug.Verifiedfields
changed
Drug.Watchedfields
changed
Drug.verifiedrevid
477316241
Drug.IUPAC_name
(2S)-2-[[(2S)-1-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoic acid | image = Alacepril.svg | image_class = skin-invert-image | tradename = | Drugs.com = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = Rx-only | routes_of_administration = Oral | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | CAS_number_Ref = | CAS_number = 74258-86-9 | ATC_prefix = none | ATC_suffix = | ATC_supplemental = | PubChem = 71992 | ChEMBL_Ref = | ChEMBL = 2103775 | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref = | ChemSpiderID = 64993 | UNII_Ref = | UNII = X39TL7JDPF | KEGG_Ref = | KEGG = D01900 | chemical_formula = | C=20 | H=26 | N=2 | O=5 | S=1 | smiles = C[C@H](CSC(=O)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)O | StdInChI_Ref = | StdInChI = 1S/C20H26N2O5S/c1-13(12-28-14(2)23)19(25)22-10-6-9-17(22)18(24)21-16(20(26)27)11-15-7-4-3-5-8-15/h3-5,7-8,13,16-17H,6,9-12H2,1-2H3,(H,21,24)(H,26,27)/t13-,16+,17+/m1/s1 | StdInChIKey_Ref = | StdInChIKey = FHHHOYXPRDYHEZ-COXVUDFISA-N

via Wikipedia infobox

Wikidata facts

Mass
406.156
Show 5 more facts
Commons category
Alacepril
chemical formula
C₂₀H₂₆N₂O₅S
isomeric SMILES
C[C@H](CSC(=O)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)O
canonical SMILES
CC(CSC(=O)C)C(=O)N1CCCC1C(=O)NC(CC2=CC=CC=C2)C(=O)O
subject has role
ACE inhibitor
Sources (2)

via Wikidata · CC0

~1 min read

Encyclopedic overview

4 sections
Contents
  • Mechanism of action
  • Synthesis
  • References
  • External links

Alacepril (INN) is an ACE inhibitor medication indicated as a treatment for hypertension. The medication metabolizes to captopril and desacetylalacepril. Alacepril is primarily used to treat hypertension, and in some cases, renovascular hypertension. It's often combined with other medications, particularly other blood pressure lowering classes of medications like thiazide diuretics to maximize its effectiveness.

== Mechanism of action == In vivo, when alacepril undergoes deacetylation, it loses a molecule similar to the amino acid phenylalanine which transforms it into captopril. Captopril then provides its blood pressure lowering effect through two ways. First, it inhibits the conversion of angiotensin 1, a precursor molecule, to angiotensin II, a vasoconstrictor that narrows blood vessels. Secondly, captopril prevents the breakdown of bradykinin, a vasodilator peptide that naturally relaxes blood vessels. ==Synthesis== [[File:Alacepril synthesis.svg|thumb|center|500px|Thieme ChemDrug Synthesis: Patents: ~65%:]] Amide formation between S-Acetylcaptopril [64838-55-7] (1) and (S)-tert-Butyl 2-amino-3-phenylpropanoate [16874-17-2] (2) gives PC86595505 (3). Deprotection with trifluoroacetic acid completed the synthesis of alacepril (4). == References ==

Excerpted from Wikipedia’s “alacepril” article, available under the CC BY-SA 4.0 licence.