Satavaptan fumarate

{{Infobox drug | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 455169440 | drug_name = Satavaptan | IUPAC_name = N-(tert-butyl)-4-{[(1s,4s)-5'-ethoxy-4-(2-morpholin-4-ylethoxy)-2'-oxospiro[cyclohexane-1,3'-indol]-1'(2'H)-yl]sulfonyl}-3-methoxybenzamide | image = Satavaptan structure.svg | image_class = skin-invert-image | width = 200 | tradename = | legal_status = | routes_of_administration = | CAS_number_Ref = | CAS_number = 185913-78-4 | ATC_prefix = none | PubChem = 9810773 | DrugBank_Ref = | UNII_Ref = | synonyms = SR121463 | UNII = AJS8S3P31H | C = 33 | H = 45 | N = 3 | O = 8 | S = 1 | ChemSpiderID_Ref = | ChemSpiderID = 32699105 | smiles = C1COCCN1CCO[C@H]2CC[C@](CC2)3c4cc(OCC)ccc4N(C3=O)S(=O)(=O)c5ccc(cc5OC)C(=O)NC(C)(C)C | StdInChI_Ref = | StdInChI = 1S/C33H45N3O8S/c1-6-43-25-8-9-27-26(22-25)33(13-11-24(12-14-33)44-20-17-35-15-18-42-19-16-35)31(38)36(27)45(39,40)29-10-7-23(21-28(29)41-5)30(37)34-32(2,3)4/h7-10,21-22,24H,6,11-20H2,1-5H3,(H,34,37)/t24-,33+ | StdInChIKey_Ref = | StdInChIKey = QKXJWFOKVQWEDZ-VCCCEUOBSA-N }}

Satavaptan (INN; developmental code name SR121463, former tentative brand name Aquilda) is a vasopressin V2 receptor antagonist which was investigation by Sanofi-Aventis and was under development for the treatment of hyponatremia. It was also being studied for the treatment of ascites. Development was discontinued in 2009.