English
tesetaxel
Sign in to saveTesetaxel is an orally administered taxane being investigated as a chemotherapy agent for various types of cancer, including breast cancer, gastric cancer, colorectal cancer, and other solid tumors. It differs from other members of the taxane class (e.g. paclitaxel or docetaxel) in that it is administered orally, not intravenously.
Wikidata facts
- Mass
- 881.411
Show 3 more facts
- chemical formula
- C₄₆H₆₀FN₃O₁₃
- canonical SMILES
- CC1=C2C3C(C4(CCC5C(C4C(C(C2(C)C)(CC1OC(=O)C(C(C6=C(C=CC=N6)F)NC(=O)OC(C)(C)C)O)O)OC(=O)C7=CC=CC=C7)(CO5)OC(=O)C)C)OC(O3)CN(C)C
- isomeric SMILES
- CC1=C2[C@@H]3[C@H]([C@@]4(CC[C@@H]5[C@]([C@H]4[C@@H]([C@@](C2(C)C)(C[C@@H]1OC(=O)[C@@H]([C@H](C6=C(C=CC=N6)F)NC(=O)OC(C)(C)C)O)O)OC(=O)C7=CC=CC=C7)(CO5)OC(=O)C)C)O[C@@H](O3)CN(C)C
Sources (2)
via Wikidata · CC0
~2 min read
Article
1 sectionsContents
- References
{{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 448210005 | IUPAC_name = (2aS,2bR,3S,4S,6S,8aR,10S,11aS,11bR,13aR)-2a-(acetyloxy)-6-{[(2R,3S)-3-[(tert-butoxycarbonyl)amino]-3-(3-fluoropyridin-2-yl)-2-hydroxypropanoyl]oxy}-10-[(dimethylamino)methyl]-4-hydroxy-7,11b,14,14-tetramethyl-2a,2b,3,4,5,6,8a,11a,11b,12,13,13a-dodecahydro-2H-4,8-methano[1,3]dioxolo[3,4]cyclodeca[1,2-d][1]benzoxet-3-yl benzoate | image = Tesetaxel.svg | image_class = skin-invert-image
| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = Investigational | routes_of_administration =